About 4-imidazol-1-yl-2,2-diphenylbutanamide
4-imidazol-1-yl-2,2-diphenylbutanamide (PubChem CID 15871723) has the molecular formula C19H19N3O
and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-imidazol-1-yl-2,2-diphenylbutanamide.
Molecular Properties
| Compound Name | 4-imidazol-1-yl-2,2-diphenylbutanamide |
| PubChem CID | 15871723 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-imidazol-1-yl-2,2-diphenylbutanamide |
| SMILES | NC(=O)C(CCn1ccnc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O/c20-18(23)19(16-7-3-1-4-8-16,17-9-5-2-6-10-17)11-13-22-14-12-21-15-22/h1-10,12,14-15H,11,13H2,(H2,20,23) |
| InChIKey | NONWQRRLZPDXTD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-imidazol-1-yl-2,2-diphenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-yl-2,2-diphenylbutanamide?
The IUPAC name of 4-imidazol-1-yl-2,2-diphenylbutanamide (CID 15871723) is 4-imidazol-1-yl-2,2-diphenylbutanamide.
What is the SMILES notation for 4-imidazol-1-yl-2,2-diphenylbutanamide?
The canonical SMILES for 4-imidazol-1-yl-2,2-diphenylbutanamide is NC(=O)C(CCn1ccnc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-imidazol-1-yl-2,2-diphenylbutanamide?
The InChIKey is NONWQRRLZPDXTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O/c20-18(23)19(16-7-3-1-4-8-16,17-9-5-2-6-10-17)11-13-22-14-12-21-15-22/h1-10,12,14-15H,11,13H2,(H2,20,23).
What are the key properties of 4-imidazol-1-yl-2,2-diphenylbutanamide?
4-imidazol-1-yl-2,2-diphenylbutanamide has a molecular weight of 305.38 g/mol, XLogP of 2.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-yl-2,2-diphenylbutanamide is sourced from PubChem (CID 15871723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).