About N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide
N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide (PubChem CID 15871729) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide |
| PubChem CID | 15871729 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN2C(=O)C[C@@H]2O1 |
| InChI | InChI=1S/C8H12N2O3/c1-5(11)9-3-6-4-10-7(12)2-8(10)13-6/h6,8H,2-4H2,1H3,(H,9,11)/t6-,8-/m0/s1 |
| InChIKey | XMACGJOIWZACGT-XPUUQOCRSA-N |
| XLogP | -0.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide?
The IUPAC name of N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide (CID 15871729) is N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide.
What is the SMILES notation for N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide?
The canonical SMILES for N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide is CC(=O)NC[C@H]1CN2C(=O)C[C@@H]2O1.
What is the InChIKey of N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide?
The InChIKey is XMACGJOIWZACGT-XPUUQOCRSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-5(11)9-3-6-4-10-7(12)2-8(10)13-6/h6,8H,2-4H2,1H3,(H,9,11)/t6-,8-/m0/s1.
What are the key properties of N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide?
N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide has a molecular weight of 184.19 g/mol, XLogP of -0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl]methyl]acetamide is sourced from PubChem (CID 15871729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).