C15H19NO — CID 158718137
3,4-dihydro-2H-naphthalen-1-one;1,2,3,4-tetrahydropyridine (PubChem CID 158718137) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 3,4-dihydro-2H-naphthalen-1-one;1,2,3,4-tetrahydropyridine.
| Compound Name | 3,4-dihydro-2H-naphthalen-1-one;1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 158718137 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3,4-dihydro-2H-naphthalen-1-one;1,2,3,4-tetrahydropyridine |
| SMILES | C1=CNCCC1.O=C1CCCc2ccccc21 |
| InChI | InChI=1S/C10H10O.C5H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-4-6-5-3-1/h1-2,4,6H,3,5,7H2;2,4,6H,1,3,5H2 |
| InChIKey | IJORKZYXOUPEEB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |