C5H10N2 — CID 15871873
2,5-dimethyl-1,3-dihydropyrazole (PubChem CID 15871873) has the molecular formula C5H10N2 and a molecular weight of 98.15 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-dihydropyrazole.
| Compound Name | 2,5-dimethyl-1,3-dihydropyrazole |
|---|---|
| PubChem CID | 15871873 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 2,5-dimethyl-1,3-dihydropyrazole |
| SMILES | CC1=CCN(C)N1 |
| InChI | InChI=1S/C5H10N2/c1-5-3-4-7(2)6-5/h3,6H,4H2,1-2H3 |
| InChIKey | OIPKZAXCUMFSTA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |