About molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine
molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine (PubChem CID 158718751) has the molecular formula C15H32F3NO2
and a molecular weight of 315.42 g/mol. Its IUPAC name is molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine.
Molecular Properties
| Compound Name | molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine |
| PubChem CID | 158718751 |
| Molecular Formula | C15H32F3NO2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine |
| SMILES | CC(C)CCCOCCOCCNC(C(C)C)C(F)(F)F.[H][H] |
| InChI | InChI=1S/C15H30F3NO2.H2/c1-12(2)6-5-8-20-10-11-21-9-7-19-14(13(3)4)15(16,17)18;/h12-14,19H,5-11H2,1-4H3;1H |
| InChIKey | IJQLWMJZLQQMDJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine?
The IUPAC name of molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine (CID 158718751) is molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine.
What is the SMILES notation for molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine?
The canonical SMILES for molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine is CC(C)CCCOCCOCCNC(C(C)C)C(F)(F)F.[H][H].
What is the InChIKey of molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine?
The InChIKey is IJQLWMJZLQQMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30F3NO2.H2/c1-12(2)6-5-8-20-10-11-21-9-7-19-14(13(3)4)15(16,17)18;/h12-14,19H,5-11H2,1-4H3;1H.
What are the key properties of molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine?
molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine has a molecular weight of 315.42 g/mol, XLogP of 3.88, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine is sourced from PubChem (CID 158718751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).