C15H26N2OS — CID 158718801
(1S)-2-(tert-butylamino)-1-(6-cyclobutyl-2-pyridinyl)ethanol;sulfane (PubChem CID 158718801) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is (1S)-2-(tert-butylamino)-1-(6-cyclobutyl-2-pyridinyl)ethanol;sulfane.
| Compound Name | (1S)-2-(tert-butylamino)-1-(6-cyclobutyl-2-pyridinyl)ethanol;sulfane |
|---|---|
| PubChem CID | 158718801 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (1S)-2-(tert-butylamino)-1-(6-cyclobutyl-2-pyridinyl)ethanol;sulfane |
| SMILES | CC(C)(C)NC[C@H](O)c1cccc(C2CCC2)n1.S |
| InChI | InChI=1S/C15H24N2O.H2S/c1-15(2,3)16-10-14(18)13-9-5-8-12(17-13)11-6-4-7-11;/h5,8-9,11,14,16,18H,4,6-7,10H2,1-3H3;1H2/t14-;/m0./s1 |
| InChIKey | IJQPFKQWQPIVHB-UQKRIMTDSA-N |
| XLogP | 2.88 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |