C13H11N3OS2 — CID 15871921
5-[(4-methylquinolin-2-yl)oxymethyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 15871921) has the molecular formula C13H11N3OS2 and a molecular weight of 289.39 g/mol. Its IUPAC name is 5-[(4-methylquinolin-2-yl)oxymethyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(4-methylquinolin-2-yl)oxymethyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 15871921 |
| Molecular Formula | C13H11N3OS2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-[(4-methylquinolin-2-yl)oxymethyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1cc(OCc2n[nH]c(=S)s2)nc2ccccc12 |
| InChI | InChI=1S/C13H11N3OS2/c1-8-6-11(14-10-5-3-2-4-9(8)10)17-7-12-15-16-13(18)19-12/h2-6H,7H2,1H3,(H,16,18) |
| InChIKey | HEVNFQJLCYWIOF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|