C12H18O3 — CID 158719806
hexane-2,5-dione;3-methylcyclopent-2-en-1-one (PubChem CID 158719806) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is hexane-2,5-dione;3-methylcyclopent-2-en-1-one.
| Compound Name | hexane-2,5-dione;3-methylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 158719806 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | hexane-2,5-dione;3-methylcyclopent-2-en-1-one |
| SMILES | CC(=O)CCC(C)=O.CC1=CC(=O)CC1 |
| InChI | InChI=1S/C6H10O2.C6H8O/c1-5(7)3-4-6(2)8;1-5-2-3-6(7)4-5/h3-4H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | IJTRCUYXNVYCLP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |