C23H21F3N2O3 — CID 158719870
6-(3-methoxyphenyl)-2-[2-oxo-1-[4-(trifluoromethyl)phenyl]pentan-3-yl]pyridazin-3-one (PubChem CID 158719870) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-2-[2-oxo-1-[4-(trifluoromethyl)phenyl]pentan-3-yl]pyridazin-3-one.
| Compound Name | 6-(3-methoxyphenyl)-2-[2-oxo-1-[4-(trifluoromethyl)phenyl]pentan-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 158719870 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 6-(3-methoxyphenyl)-2-[2-oxo-1-[4-(trifluoromethyl)phenyl]pentan-3-yl]pyridazin-3-one |
| SMILES | CCC(C(=O)Cc1ccc(C(F)(F)F)cc1)n1nc(-c2cccc(OC)c2)ccc1=O |
| InChI | InChI=1S/C23H21F3N2O3/c1-3-20(21(29)13-15-7-9-17(10-8-15)23(24,25)26)28-22(30)12-11-19(27-28)16-5-4-6-18(14-16)31-2/h4-12,14,20H,3,13H2,1-2H3 |
| InChIKey | IJTWPTFBVSHOBZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |