C29H26BrN5OS — CID 158719910
1-(5-bromo-2-methoxyphenyl)-3-[3-[5-methyl-4-(pyridin-3-ylmethylamino)pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]propane-2-thione (PubChem CID 158719910) has the molecular formula C29H26BrN5OS and a molecular weight of 572.53 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3-[3-[5-methyl-4-(pyridin-3-ylmethylamino)pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]propane-2-thione.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3-[3-[5-methyl-4-(pyridin-3-ylmethylamino)pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]propane-2-thione |
|---|---|
| PubChem CID | 158719910 |
| Molecular Formula | C29H26BrN5OS |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3-[3-[5-methyl-4-(pyridin-3-ylmethylamino)pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]propane-2-thione |
| SMILES | COc1ccc(Br)cc1CC(=S)Cc1cccc(-c2nc(NCc3cccnc3)c3c(ccn3C)n2)c1 |
| InChI | InChI=1S/C29H26BrN5OS/c1-35-12-10-25-27(35)29(32-18-20-6-4-11-31-17-20)34-28(33-25)21-7-3-5-19(13-21)14-24(37)16-22-15-23(30)8-9-26(22)36-2/h3-13,15,17H,14,16,18H2,1-2H3,(H,32,33,34) |
| InChIKey | OROWMSGDLLPDNC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|