C30H30N2O9 — CID 158720221
[4,5-diacetyloxy-2,4-dimethyl-6-[(3E)-3-(1-methyl-2-oxoindol-3-ylidene)-2-oxoindol-1-yl]oxan-3-yl] acetate (PubChem CID 158720221) has the molecular formula C30H30N2O9 and a molecular weight of 562.58 g/mol. Its IUPAC name is [4,5-diacetyloxy-2,4-dimethyl-6-[(3E)-3-(1-methyl-2-oxoindol-3-ylidene)-2-oxoindol-1-yl]oxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-2,4-dimethyl-6-[(3E)-3-(1-methyl-2-oxoindol-3-ylidene)-2-oxoindol-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 158720221 |
| Molecular Formula | C30H30N2O9 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | [4,5-diacetyloxy-2,4-dimethyl-6-[(3E)-3-(1-methyl-2-oxoindol-3-ylidene)-2-oxoindol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(C)OC(N2C(=O)/C(=C3/C(=O)N(C)c4ccccc43)c3ccccc32)C(OC(C)=O)C1(C)OC(C)=O |
| InChI | InChI=1S/C30H30N2O9/c1-15-25(39-16(2)33)30(5,41-18(4)35)26(40-17(3)34)29(38-15)32-22-14-10-8-12-20(22)24(28(32)37)23-19-11-7-9-13-21(19)31(6)27(23)36/h7-15,25-26,29H,1-6H3/b24-23+ |
| InChIKey | PZPJXWONPSLXNO-WCWDXBQESA-N |
| XLogP | 2.85 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|