C36H42B2F4O14 — CID 158720236
1-[5-(1,2-dihydroxyethyl)-2-[2-fluoro-4-(3-fluorophenyl)phenyl]-1,3,2-dioxaborolan-4-yl]ethane-1,2-diol;[2-fluoro-4-(3-fluorophenyl)phenyl]boronic acid;hexane-1,2,3,4,5,6-hexol (PubChem CID 158720236) has the molecular formula C36H42B2F4O14 and a molecular weight of 796.33 g/mol. Its IUPAC name is 1-[5-(1,2-dihydroxyethyl)-2-[2-fluoro-4-(3-fluorophenyl)phenyl]-1,3,2-dioxaborolan-4-yl]ethane-1,2-diol;[2-fluoro-4-(3-fluorophenyl)phenyl]boronic acid;hexane-1,2,3,4,5,6-hexol.
| Compound Name | 1-[5-(1,2-dihydroxyethyl)-2-[2-fluoro-4-(3-fluorophenyl)phenyl]-1,3,2-dioxaborolan-4-yl]ethane-1,2-diol;[2-fluoro-4-(3-fluorophenyl)phenyl]boronic acid;hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 158720236 |
| Molecular Formula | C36H42B2F4O14 |
| Molecular Weight | 796.33 g/mol |
| Exact Mass | 796.27 |
| IUPAC Name | 1-[5-(1,2-dihydroxyethyl)-2-[2-fluoro-4-(3-fluorophenyl)phenyl]-1,3,2-dioxaborolan-4-yl]ethane-1,2-diol;[2-fluoro-4-(3-fluorophenyl)phenyl]boronic acid;hexane-1,2,3,4,5,6-hexol |
| SMILES | OB(O)c1ccc(-c2cccc(F)c2)cc1F.OCC(O)C(O)C(O)C(O)CO.OCC(O)C1OB(c2ccc(-c3cccc(F)c3)cc2F)OC1C(O)CO |
| InChI | InChI=1S/C18H19BF2O6.C12H9BF2O2.C6H14O6/c20-12-3-1-2-10(6-12)11-4-5-13(14(21)7-11)19-26-17(15(24)8-22)18(27-19)16(25)9-23;14-10-3-1-2-8(6-10)9-4-5-11(13(16)17)12(15)7-9;7-1-3(9)5(11)6(12)4(10)2-8/h1-7,15-18,22-25H,8-9H2;1-7,16-17H;3-12H,1-2H2 |
| InChIKey | IJVBYMKSPPRQJG-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 261.22 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.33 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|