C31H31N3O7S — CID 15872199
cyclopentyl N-[1-formyl-3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]indol-5-yl]carbamate (PubChem CID 15872199) has the molecular formula C31H31N3O7S and a molecular weight of 589.67 g/mol. Its IUPAC name is cyclopentyl N-[1-formyl-3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]indol-5-yl]carbamate.
| Compound Name | cyclopentyl N-[1-formyl-3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]indol-5-yl]carbamate |
|---|---|
| PubChem CID | 15872199 |
| Molecular Formula | C31H31N3O7S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | cyclopentyl N-[1-formyl-3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]indol-5-yl]carbamate |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2C)ccc1Cc1cn(C=O)c2ccc(NC(=O)OC3CCCC3)cc12 |
| InChI | InChI=1S/C31H31N3O7S/c1-20-7-3-6-10-29(20)42(38,39)33-30(36)22-12-11-21(28(16-22)40-2)15-23-18-34(19-35)27-14-13-24(17-26(23)27)32-31(37)41-25-8-4-5-9-25/h3,6-7,10-14,16-19,25H,4-5,8-9,15H2,1-2H3,(H,32,37)(H,33,36) |
| InChIKey | QFJPULMRRDJZJA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|