About 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane
2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane (PubChem CID 158723630) has the molecular formula C9H18BrClN2O
and a molecular weight of 285.61 g/mol. Its IUPAC name is 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane.
Molecular Properties
| Compound Name | 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane |
| PubChem CID | 158723630 |
| Molecular Formula | C9H18BrClN2O |
| Molecular Weight | 285.61 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane |
| SMILES | CCl.O=C(CBr)NCCN1CCCC1 |
| InChI | InChI=1S/C8H15BrN2O.CH3Cl/c9-7-8(12)10-3-6-11-4-1-2-5-11;1-2/h1-7H2,(H,10,12);1H3 |
| InChIKey | IKFLIEKXBCSILL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane?
The IUPAC name of 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane (CID 158723630) is 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane.
What is the SMILES notation for 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane?
The canonical SMILES for 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane is CCl.O=C(CBr)NCCN1CCCC1.
What is the InChIKey of 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane?
The InChIKey is IKFLIEKXBCSILL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrN2O.CH3Cl/c9-7-8(12)10-3-6-11-4-1-2-5-11;1-2/h1-7H2,(H,10,12);1H3.
What are the key properties of 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane?
2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane has a molecular weight of 285.61 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(2-pyrrolidin-1-ylethyl)acetamide;chloromethane is sourced from PubChem (CID 158723630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).