C50H35N5Si — CID 158724090
[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-diphenyl-(9-phenylpyrido[2,3-b]indol-6-yl)silane (PubChem CID 158724090) has the molecular formula C50H35N5Si and a molecular weight of 733.95 g/mol. Its IUPAC name is [3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-diphenyl-(9-phenylpyrido[2,3-b]indol-6-yl)silane.
| Compound Name | [3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-diphenyl-(9-phenylpyrido[2,3-b]indol-6-yl)silane |
|---|---|
| PubChem CID | 158724090 |
| Molecular Formula | C50H35N5Si |
| Molecular Weight | 733.95 g/mol |
| Exact Mass | 733.27 |
| IUPAC Name | [3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-diphenyl-(9-phenylpyrido[2,3-b]indol-6-yl)silane |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccc5c(c4)c4cccnc4n5-c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C50H35N5Si/c1-6-18-36(19-7-1)47-52-48(37-20-8-2-9-21-37)54-49(53-47)38-22-16-29-42(34-38)56(40-25-12-4-13-26-40,41-27-14-5-15-28-41)43-31-32-46-45(35-43)44-30-17-33-51-50(44)55(46)39-23-10-3-11-24-39/h1-35H |
| InChIKey | ONMZKKVCCYIJBQ-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.95 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|