H3BaO8PS — CID 158725602
barium(2+);phosphoric acid;sulfate (PubChem CID 158725602) has the molecular formula H3BaO8PS and a molecular weight of 331.39 g/mol. Its IUPAC name is barium(2+);phosphoric acid;sulfate.
| Compound Name | barium(2+);phosphoric acid;sulfate |
|---|---|
| PubChem CID | 158725602 |
| Molecular Formula | H3BaO8PS |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.83 |
| IUPAC Name | barium(2+);phosphoric acid;sulfate |
| SMILES | O=P(O)(O)O.O=S(=O)([O-])[O-].[Ba+2] |
| InChI | InChI=1S/Ba.H3O4P.H2O4S/c;2*1-5(2,3)4/h;(H3,1,2,3,4);(H2,1,2,3,4)/q+2;;/p-2 |
| InChIKey | IKLOZJCLHPJRPG-UHFFFAOYSA-L |
| XLogP | -2.65 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|