C33H28N4O4S — CID 158726369
hepta-1,3,5-triyne;3-[3-[[pyridin-2-ylsulfonyl-[(4-pyrimidin-5-ylphenyl)methyl]amino]methyl]phenyl]propanoic acid (PubChem CID 158726369) has the molecular formula C33H28N4O4S and a molecular weight of 576.68 g/mol. Its IUPAC name is hepta-1,3,5-triyne;3-[3-[[pyridin-2-ylsulfonyl-[(4-pyrimidin-5-ylphenyl)methyl]amino]methyl]phenyl]propanoic acid.
| Compound Name | hepta-1,3,5-triyne;3-[3-[[pyridin-2-ylsulfonyl-[(4-pyrimidin-5-ylphenyl)methyl]amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 158726369 |
| Molecular Formula | C33H28N4O4S |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | hepta-1,3,5-triyne;3-[3-[[pyridin-2-ylsulfonyl-[(4-pyrimidin-5-ylphenyl)methyl]amino]methyl]phenyl]propanoic acid |
| SMILES | C#CC#CC#CC.O=C(O)CCc1cccc(CN(Cc2ccc(-c3cncnc3)cc2)S(=O)(=O)c2ccccn2)c1 |
| InChI | InChI=1S/C26H24N4O4S.C7H4/c31-26(32)12-9-20-4-3-5-22(14-20)18-30(35(33,34)25-6-1-2-13-29-25)17-21-7-10-23(11-8-21)24-15-27-19-28-16-24;1-3-5-7-6-4-2/h1-8,10-11,13-16,19H,9,12,17-18H2,(H,31,32);1H,2H3 |
| InChIKey | IKNXYZFPNOSDEN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|