C25H22F6N6O6S3 — CID 158726413
4-[3-[4-(1,2-diaminoethylideneamino)-2-methyl-6-nitrophenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 158726413) has the molecular formula C25H22F6N6O6S3 and a molecular weight of 712.68 g/mol. Its IUPAC name is 4-[3-[4-(1,2-diaminoethylideneamino)-2-methyl-6-nitrophenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 4-[3-[4-(1,2-diaminoethylideneamino)-2-methyl-6-nitrophenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 158726413 |
| Molecular Formula | C25H22F6N6O6S3 |
| Molecular Weight | 712.68 g/mol |
| Exact Mass | 712.07 |
| IUPAC Name | 4-[3-[4-(1,2-diaminoethylideneamino)-2-methyl-6-nitrophenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3c(C)cc(/N=C(/N)CN)cc3[N+](=O)[O-])c2)c(SC)s1 |
| InChI | InChI=1S/C21H22N6O4S3.C4F6O2/c1-11-6-13(26-18(23)10-22)8-15(27(28)29)19(11)12-4-3-5-14(7-12)34(30,31)17-9-16(20(24)25)33-21(17)32-2;5-3(6,7)1(11)2(12)4(8,9)10/h3-9H,10,22H2,1-2H3,(H2,23,26)(H3,24,25); |
| InChIKey | IKOAYYNXUQZIOH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 225.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|