C19H12Cl4O2 — CID 158726549
3-[phenyl-(2,3,4,5-tetrachlorophenyl)methyl]benzene-1,2-diol (PubChem CID 158726549) has the molecular formula C19H12Cl4O2 and a molecular weight of 414.12 g/mol. Its IUPAC name is 3-[phenyl-(2,3,4,5-tetrachlorophenyl)methyl]benzene-1,2-diol.
| Compound Name | 3-[phenyl-(2,3,4,5-tetrachlorophenyl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 158726549 |
| Molecular Formula | C19H12Cl4O2 |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | 3-[phenyl-(2,3,4,5-tetrachlorophenyl)methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(C(c2ccccc2)c2cc(Cl)c(Cl)c(Cl)c2Cl)c1O |
| InChI | InChI=1S/C19H12Cl4O2/c20-13-9-12(16(21)18(23)17(13)22)15(10-5-2-1-3-6-10)11-7-4-8-14(24)19(11)25/h1-9,15,24-25H |
| InChIKey | IKOMZJIQDQRGFN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|