About 6-ethenoxyhex-1-en-3-one
6-ethenoxyhex-1-en-3-one (PubChem CID 158727116) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 6-ethenoxyhex-1-en-3-one.
Molecular Properties
| Compound Name | 6-ethenoxyhex-1-en-3-one |
| PubChem CID | 158727116 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 6-ethenoxyhex-1-en-3-one |
| SMILES | C=COCCCC(=O)C=C |
| InChI | InChI=1S/C8H12O2/c1-3-8(9)6-5-7-10-4-2/h3-4H,1-2,5-7H2 |
| InChIKey | IKQJYYWJFLPGDR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenoxyhex-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenoxyhex-1-en-3-one?
The IUPAC name of 6-ethenoxyhex-1-en-3-one (CID 158727116) is 6-ethenoxyhex-1-en-3-one.
What is the SMILES notation for 6-ethenoxyhex-1-en-3-one?
The canonical SMILES for 6-ethenoxyhex-1-en-3-one is C=COCCCC(=O)C=C.
What is the InChIKey of 6-ethenoxyhex-1-en-3-one?
The InChIKey is IKQJYYWJFLPGDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-3-8(9)6-5-7-10-4-2/h3-4H,1-2,5-7H2.
What are the key properties of 6-ethenoxyhex-1-en-3-one?
6-ethenoxyhex-1-en-3-one has a molecular weight of 140.18 g/mol, XLogP of 1.68, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenoxyhex-1-en-3-one is sourced from PubChem (CID 158727116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).