C28H44N12+2 — CID 158727997
N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]-N,N'-dimethylbutane-1,4-diamine;methane (PubChem CID 158727997) has the molecular formula C28H44N12+2 and a molecular weight of 548.74 g/mol. Its IUPAC name is N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]-N,N'-dimethylbutane-1,4-diamine;methane.
| Compound Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]-N,N'-dimethylbutane-1,4-diamine;methane |
|---|---|
| PubChem CID | 158727997 |
| Molecular Formula | C28H44N12+2 |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]-N,N'-dimethylbutane-1,4-diamine;methane |
| SMILES | C.C.CN(CCCCN(C)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1 |
| InChI | InChI=1S/C26H36N12.2CH4/c1-33(23-13-9-21(10-14-23)29-31-25-35(3)19-27-37(25)5)17-7-8-18-34(2)24-15-11-22(12-16-24)30-32-26-36(4)20-28-38(26)6;;/h9-16,19-20H,7-8,17-18H2,1-6H3;2*1H4/q+2;; |
| InChIKey | IKTBMRIFFQKQHI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|