About bis(2-tert-butyl-6-methylphenol);dichlorotitanium
bis(2-tert-butyl-6-methylphenol);dichlorotitanium (PubChem CID 15872809) has the molecular formula C22H32Cl2O2Ti
and a molecular weight of 447.27 g/mol. Its IUPAC name is bis(2-tert-butyl-6-methylphenol);dichlorotitanium.
Molecular Properties
| Compound Name | bis(2-tert-butyl-6-methylphenol);dichlorotitanium |
| PubChem CID | 15872809 |
| Molecular Formula | C22H32Cl2O2Ti |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | bis(2-tert-butyl-6-methylphenol);dichlorotitanium |
| SMILES | Cc1cccc(C(C)(C)C)c1O.Cc1cccc(C(C)(C)C)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/2C11H16O.2ClH.Ti/c2*1-8-6-5-7-9(10(8)12)11(2,3)4;;;/h2*5-7,12H,1-4H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | XPWCJQHEDOTLET-UHFFFAOYSA-L |
| XLogP | 7.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-tert-butyl-6-methylphenol);dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-tert-butyl-6-methylphenol);dichlorotitanium?
The IUPAC name of bis(2-tert-butyl-6-methylphenol);dichlorotitanium (CID 15872809) is bis(2-tert-butyl-6-methylphenol);dichlorotitanium.
What is the SMILES notation for bis(2-tert-butyl-6-methylphenol);dichlorotitanium?
The canonical SMILES for bis(2-tert-butyl-6-methylphenol);dichlorotitanium is Cc1cccc(C(C)(C)C)c1O.Cc1cccc(C(C)(C)C)c1O.Cl[Ti]Cl.
What is the InChIKey of bis(2-tert-butyl-6-methylphenol);dichlorotitanium?
The InChIKey is XPWCJQHEDOTLET-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H16O.2ClH.Ti/c2*1-8-6-5-7-9(10(8)12)11(2,3)4;;;/h2*5-7,12H,1-4H3;2*1H;/q;;;;+2/p-2.
What are the key properties of bis(2-tert-butyl-6-methylphenol);dichlorotitanium?
bis(2-tert-butyl-6-methylphenol);dichlorotitanium has a molecular weight of 447.27 g/mol, XLogP of 7.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-tert-butyl-6-methylphenol);dichlorotitanium is sourced from PubChem (CID 15872809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).