About [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate
[2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate (PubChem CID 158728455) has the molecular formula C14H24O6
and a molecular weight of 288.34 g/mol. Its IUPAC name is [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate.
Molecular Properties
| Compound Name | [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate |
| PubChem CID | 158728455 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate |
| SMILES | CC(=O)OC(OC(C)C)(OC(C)C)C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C14H24O6/c1-8(2)18-14(19-9(3)4,20-12(7)17)13(10(5)15)11(6)16/h8-9,13H,1-7H3 |
| InChIKey | RLFWWWOGUOTHBK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate?
The IUPAC name of [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate (CID 158728455) is [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate.
What is the SMILES notation for [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate?
The canonical SMILES for [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate is CC(=O)OC(OC(C)C)(OC(C)C)C(C(C)=O)C(C)=O.
What is the InChIKey of [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate?
The InChIKey is RLFWWWOGUOTHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O6/c1-8(2)18-14(19-9(3)4,20-12(7)17)13(10(5)15)11(6)16/h8-9,13H,1-7H3.
What are the key properties of [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate?
[2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate has a molecular weight of 288.34 g/mol, XLogP of 1.85, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-acetyl-3-oxo-1,1-di(propan-2-yloxy)butyl] acetate is sourced from PubChem (CID 158728455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).