C15H24N4O2 — CID 158730782
2-methyl-4-N-(2-piperidin-3-ylethyl)-1H-pyridine-2,4-dicarboxamide (PubChem CID 158730782) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-methyl-4-N-(2-piperidin-3-ylethyl)-1H-pyridine-2,4-dicarboxamide.
| Compound Name | 2-methyl-4-N-(2-piperidin-3-ylethyl)-1H-pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 158730782 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-methyl-4-N-(2-piperidin-3-ylethyl)-1H-pyridine-2,4-dicarboxamide |
| SMILES | CC1(C(N)=O)C=C(C(=O)NCCC2CCCNC2)C=CN1 |
| InChI | InChI=1S/C15H24N4O2/c1-15(14(16)21)9-12(5-8-19-15)13(20)18-7-4-11-3-2-6-17-10-11/h5,8-9,11,17,19H,2-4,6-7,10H2,1H3,(H2,16,21)(H,18,20) |
| InChIKey | ILBMYXMXTASOTF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |