About 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane
5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane (PubChem CID 158731739) has the molecular formula C13H18ClNO2
and a molecular weight of 255.75 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane |
| PubChem CID | 158731739 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane |
| SMILES | CC(C)C.O=C1NCC(c2ccccc2Cl)O1 |
| InChI | InChI=1S/C9H8ClNO2.C4H10/c10-7-4-2-1-3-6(7)8-5-11-9(12)13-8;1-4(2)3/h1-4,8H,5H2,(H,11,12);4H,1-3H3 |
| InChIKey | ILEISMWQVGHFNV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane?
The IUPAC name of 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane (CID 158731739) is 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane.
What is the SMILES notation for 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane?
The canonical SMILES for 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane is CC(C)C.O=C1NCC(c2ccccc2Cl)O1.
What is the InChIKey of 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane?
The InChIKey is ILEISMWQVGHFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO2.C4H10/c10-7-4-2-1-3-6(7)8-5-11-9(12)13-8;1-4(2)3/h1-4,8H,5H2,(H,11,12);4H,1-3H3.
What are the key properties of 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane?
5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane has a molecular weight of 255.75 g/mol, XLogP of 3.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)-1,3-oxazolidin-2-one;2-methylpropane is sourced from PubChem (CID 158731739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).