About [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate
[8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate (PubChem CID 158732010) has the molecular formula C28H37O3S+
and a molecular weight of 453.67 g/mol. Its IUPAC name is [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate.
Molecular Properties
| Compound Name | [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate |
| PubChem CID | 158732010 |
| Molecular Formula | C28H37O3S+ |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate |
| SMILES | CC(C)(C)c1ccc([S+]2C3CC4COC(C3OC(=O)C35CC6CC(CC(C6)C3)C5)C42)cc1 |
| InChI | InChI=1S/C28H37O3S/c1-27(2,3)20-4-6-21(7-5-20)32-22-11-19-15-30-24(25(19)32)23(22)31-26(29)28-12-16-8-17(13-28)10-18(9-16)14-28/h4-7,16-19,22-25H,8-15H2,1-3H3/q+1 |
| InChIKey | ZYYIYVIOBHVPLO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate?
The IUPAC name of [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate (CID 158732010) is [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate.
What is the SMILES notation for [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate?
The canonical SMILES for [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate is CC(C)(C)c1ccc([S+]2C3CC4COC(C3OC(=O)C35CC6CC(CC(C6)C3)C5)C42)cc1.
What is the InChIKey of [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate?
The InChIKey is ZYYIYVIOBHVPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37O3S/c1-27(2,3)20-4-6-21(7-5-20)32-22-11-19-15-30-24(25(19)32)23(22)31-26(29)28-12-16-8-17(13-28)10-18(9-16)14-28/h4-7,16-19,22-25H,8-15H2,1-3H3/q+1.
What are the key properties of [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate?
[8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate has a molecular weight of 453.67 g/mol, XLogP of 5.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(4-tert-butylphenyl)-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate is sourced from PubChem (CID 158732010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).