C23H16FN3O3 — CID 158732124
4-(1,2-benzoxazol-3-yl)-5-(6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)cyclopent-4-ene-1,3-dione (PubChem CID 158732124) has the molecular formula C23H16FN3O3 and a molecular weight of 401.40 g/mol. Its IUPAC name is 4-(1,2-benzoxazol-3-yl)-5-(6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)cyclopent-4-ene-1,3-dione.
| Compound Name | 4-(1,2-benzoxazol-3-yl)-5-(6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 158732124 |
| Molecular Formula | C23H16FN3O3 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-(1,2-benzoxazol-3-yl)-5-(6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)cyclopent-4-ene-1,3-dione |
| SMILES | O=C1CC(=O)C(c2cn3c4c(cc(F)cc24)CNCC3)=C1c1noc2ccccc12 |
| InChI | InChI=1S/C23H16FN3O3/c24-13-7-12-10-25-5-6-27-11-16(15(8-13)23(12)27)20-17(28)9-18(29)21(20)22-14-3-1-2-4-19(14)30-26-22/h1-4,7-8,11,25H,5-6,9-10H2 |
| InChIKey | FYGUENLOYCMIIJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|