C29H23ClN4O — CID 158732374
1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-5-indazol-1-ylpentan-1-one (PubChem CID 158732374) has the molecular formula C29H23ClN4O and a molecular weight of 478.98 g/mol. Its IUPAC name is 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-5-indazol-1-ylpentan-1-one.
| Compound Name | 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-5-indazol-1-ylpentan-1-one |
|---|---|
| PubChem CID | 158732374 |
| Molecular Formula | C29H23ClN4O |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-5-indazol-1-ylpentan-1-one |
| SMILES | Nc1ncc2ccc(Cl)cc2c1C#Cc1ccc(C(=O)CCCCn2ncc3ccccc32)cc1 |
| InChI | InChI=1S/C29H23ClN4O/c30-24-14-13-22-18-32-29(31)25(26(22)17-24)15-10-20-8-11-21(12-9-20)28(35)7-3-4-16-34-27-6-2-1-5-23(27)19-33-34/h1-2,5-6,8-9,11-14,17-19H,3-4,7,16H2,(H2,31,32) |
| InChIKey | FMFOQRDSOQBKDR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|