About aniline;naphthalen-2-amine
aniline;naphthalen-2-amine (PubChem CID 158733233) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is aniline;naphthalen-2-amine.
Molecular Properties
| Compound Name | aniline;naphthalen-2-amine |
| PubChem CID | 158733233 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | aniline;naphthalen-2-amine |
| SMILES | Nc1ccc2ccccc2c1.Nc1ccccc1 |
| InChI | InChI=1S/C10H9N.C6H7N/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-6-4-2-1-3-5-6/h1-7H,11H2;1-5H,7H2 |
| InChIKey | ILIXPAUMNCDWLL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;naphthalen-2-amine?
The IUPAC name of aniline;naphthalen-2-amine (CID 158733233) is aniline;naphthalen-2-amine.
What is the SMILES notation for aniline;naphthalen-2-amine?
The canonical SMILES for aniline;naphthalen-2-amine is Nc1ccc2ccccc2c1.Nc1ccccc1.
What is the InChIKey of aniline;naphthalen-2-amine?
The InChIKey is ILIXPAUMNCDWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C6H7N/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-6-4-2-1-3-5-6/h1-7H,11H2;1-5H,7H2.
What are the key properties of aniline;naphthalen-2-amine?
aniline;naphthalen-2-amine has a molecular weight of 236.32 g/mol, XLogP of 3.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;naphthalen-2-amine is sourced from PubChem (CID 158733233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).