C13H21F6N3O3 — CID 158733323
2-[[[2-[dimethylamino(difluoro)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]methyl-dimethylazaniumyl]acetate;ethene (PubChem CID 158733323) has the molecular formula C13H21F6N3O3 and a molecular weight of 381.32 g/mol. Its IUPAC name is 2-[[[2-[dimethylamino(difluoro)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]methyl-dimethylazaniumyl]acetate;ethene.
| Compound Name | 2-[[[2-[dimethylamino(difluoro)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]methyl-dimethylazaniumyl]acetate;ethene |
|---|---|
| PubChem CID | 158733323 |
| Molecular Formula | C13H21F6N3O3 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[[[2-[dimethylamino(difluoro)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]methyl-dimethylazaniumyl]acetate;ethene |
| SMILES | C=C.CN(C)C(F)(F)C(F)(C(=O)NC[N+](C)(C)CC(=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C11H17F6N3O3.C2H4/c1-19(2)11(16,17)9(12,10(13,14)15)8(23)18-6-20(3,4)5-7(21)22;1-2/h5-6H2,1-4H3,(H-,18,21,22,23);1-2H2 |
| InChIKey | ILJDIZFQQHHOOQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|