C21H25BF3NO5 — CID 158734290
N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-3-yl]-1-(3,3,3-trifluoro-2-oxopropyl)cyclopropane-1-carboxamide (PubChem CID 158734290) has the molecular formula C21H25BF3NO5 and a molecular weight of 439.24 g/mol. Its IUPAC name is N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-3-yl]-1-(3,3,3-trifluoro-2-oxopropyl)cyclopropane-1-carboxamide.
| Compound Name | N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-3-yl]-1-(3,3,3-trifluoro-2-oxopropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 158734290 |
| Molecular Formula | C21H25BF3NO5 |
| Molecular Weight | 439.24 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-3-yl]-1-(3,3,3-trifluoro-2-oxopropyl)cyclopropane-1-carboxamide |
| SMILES | CC1(C)OB(c2ccc3c(c2)OCC3NC(=O)C2(CC(=O)C(F)(F)F)CC2)OC1(C)C |
| InChI | InChI=1S/C21H25BF3NO5/c1-18(2)19(3,4)31-22(30-18)12-5-6-13-14(11-29-15(13)9-12)26-17(28)20(7-8-20)10-16(27)21(23,24)25/h5-6,9,14H,7-8,10-11H2,1-4H3,(H,26,28) |
| InChIKey | ILMBYUAQIUQEBZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|