About 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene
1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene (PubChem CID 15873435) has the molecular formula C18H32O6P2
and a molecular weight of 406.40 g/mol. Its IUPAC name is 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene.
Molecular Properties
| Compound Name | 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene |
| PubChem CID | 15873435 |
| Molecular Formula | C18H32O6P2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene |
| SMILES | CCOP(=O)(OCC)c1cc(C(C)(C)C)cc(P(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C18H32O6P2/c1-8-21-25(19,22-9-2)16-12-15(18(5,6)7)13-17(14-16)26(20,23-10-3)24-11-4/h12-14H,8-11H2,1-7H3 |
| InChIKey | CUMSOMFXGFSQTD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene?
The IUPAC name of 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene (CID 15873435) is 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene.
What is the SMILES notation for 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene?
The canonical SMILES for 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene is CCOP(=O)(OCC)c1cc(C(C)(C)C)cc(P(=O)(OCC)OCC)c1.
What is the InChIKey of 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene?
The InChIKey is CUMSOMFXGFSQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O6P2/c1-8-21-25(19,22-9-2)16-12-15(18(5,6)7)13-17(14-16)26(20,23-10-3)24-11-4/h12-14H,8-11H2,1-7H3.
What are the key properties of 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene?
1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene has a molecular weight of 406.40 g/mol, XLogP of 4.77, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,5-bis(diethoxyphosphoryl)benzene is sourced from PubChem (CID 15873435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).