C22H23N7O — CID 158734899
(17R)-20-amino-4,9,14,17-tetramethyl-18-oxa-4,5,9,21,23-pentazapentacyclo[17.3.1.02,6.08,10.011,16]tricosa-1(22),2,5,11(16),12,14,19(23),20-octaene-3-carbonitrile (PubChem CID 158734899) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is (17R)-20-amino-4,9,14,17-tetramethyl-18-oxa-4,5,9,21,23-pentazapentacyclo[17.3.1.02,6.08,10.011,16]tricosa-1(22),2,5,11(16),12,14,19(23),20-octaene-3-carbonitrile.
| Compound Name | (17R)-20-amino-4,9,14,17-tetramethyl-18-oxa-4,5,9,21,23-pentazapentacyclo[17.3.1.02,6.08,10.011,16]tricosa-1(22),2,5,11(16),12,14,19(23),20-octaene-3-carbonitrile |
|---|---|
| PubChem CID | 158734899 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (17R)-20-amino-4,9,14,17-tetramethyl-18-oxa-4,5,9,21,23-pentazapentacyclo[17.3.1.02,6.08,10.011,16]tricosa-1(22),2,5,11(16),12,14,19(23),20-octaene-3-carbonitrile |
| SMILES | Cc1ccc2c(c1)[C@@H](C)Oc1nc(cnc1N)-c1c(nn(C)c1C#N)CC1C2N1C |
| InChI | InChI=1S/C22H23N7O/c1-11-5-6-13-14(7-11)12(2)30-22-21(24)25-10-16(26-22)19-15(8-17-20(13)28(17)3)27-29(4)18(19)9-23/h5-7,10,12,17,20H,8H2,1-4H3,(H2,24,25)/t12-,17?,20?,28?/m1/s1 |
| InChIKey | NNOWPDXOIMORHQ-IUSPUZKNSA-N |
| XLogP | 2.69 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|