C35H51N9O2 — CID 158735174
(2,6-ditert-butyl-4-methylcyclohexyl) 2-tert-butyl-6-cyano-5-[(6-ethyl-2-propan-2-ylpyrazolo[1,5-b][1,2,4]triazol-7-ylidene)amino]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 158735174) has the molecular formula C35H51N9O2 and a molecular weight of 629.85 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylcyclohexyl) 2-tert-butyl-6-cyano-5-[(6-ethyl-2-propan-2-ylpyrazolo[1,5-b][1,2,4]triazol-7-ylidene)amino]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylcyclohexyl) 2-tert-butyl-6-cyano-5-[(6-ethyl-2-propan-2-ylpyrazolo[1,5-b][1,2,4]triazol-7-ylidene)amino]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 158735174 |
| Molecular Formula | C35H51N9O2 |
| Molecular Weight | 629.85 g/mol |
| Exact Mass | 629.42 |
| IUPAC Name | (2,6-ditert-butyl-4-methylcyclohexyl) 2-tert-butyl-6-cyano-5-[(6-ethyl-2-propan-2-ylpyrazolo[1,5-b][1,2,4]triazol-7-ylidene)amino]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | CCC1=Nn2nc(C(C)C)nc2C1=Nc1c(C#N)c(C(=O)OC2C(C(C)(C)C)CC(C)CC2C(C)(C)C)c2nc(C(C)(C)C)[nH]n12 |
| InChI | InChI=1S/C35H51N9O2/c1-14-23-25(30-38-27(18(2)3)41-44(30)40-23)37-28-20(17-36)24(29-39-32(35(11,12)13)42-43(28)29)31(45)46-26-21(33(5,6)7)15-19(4)16-22(26)34(8,9)10/h18-19,21-22,26H,14-16H2,1-13H3,(H,39,42) |
| InChIKey | HILMOBQWFKQFHD-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.85 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|