C35H66N2O9 — CID 158735519
1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-ol;[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 158735519) has the molecular formula C35H66N2O9 and a molecular weight of 658.92 g/mol. Its IUPAC name is 1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-ol;[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | 1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-ol;[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158735519 |
| Molecular Formula | C35H66N2O9 |
| Molecular Weight | 658.92 g/mol |
| Exact Mass | 658.48 |
| IUPAC Name | 1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-ol;[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OC1CC(C)(C)N(OCC(C)(C)O)C(C)(C)C1.CC(C)(O)CON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C17H31NO4.C13H27NO3.C5H8O2/c1-12(2)14(19)22-13-9-15(3,4)18(16(5,6)10-13)21-11-17(7,8)20;1-11(2)7-10(15)8-12(3,4)14(11)17-9-13(5,6)16;1-4(2)5(6)7-3/h13,20H,1,9-11H2,2-8H3;10,15-16H,7-9H2,1-6H3;1H2,2-3H3 |
| InChIKey | ILPZEKIGXJFFSD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|