C18H21N5O4S — CID 158735878
(E)-but-2-enedioic acid;5-[6-(1,4-diazabicyclo[3.2.2]nonan-4-yl)pyridazin-3-yl]-1,3-thiazole (PubChem CID 158735878) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-[6-(1,4-diazabicyclo[3.2.2]nonan-4-yl)pyridazin-3-yl]-1,3-thiazole.
| Compound Name | (E)-but-2-enedioic acid;5-[6-(1,4-diazabicyclo[3.2.2]nonan-4-yl)pyridazin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 158735878 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (E)-but-2-enedioic acid;5-[6-(1,4-diazabicyclo[3.2.2]nonan-4-yl)pyridazin-3-yl]-1,3-thiazole |
| SMILES | O=C(O)/C=C/C(=O)O.c1ncc(-c2ccc(N3CCN4CCC3CC4)nn2)s1 |
| InChI | InChI=1S/C14H17N5S.C4H4O4/c1-2-14(17-16-12(1)13-9-15-10-20-13)19-8-7-18-5-3-11(19)4-6-18;5-3(6)1-2-4(7)8/h1-2,9-11H,3-8H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ILRBYMXXVMTZRF-WLHGVMLRSA-N |
| XLogP | 1.60 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|