C46H57IO4 — CID 158736643
5,7-ditert-butyl-3-methyl-3-phenyl-1-benzofuran-2-one;5,7-ditert-butyl-3-phenyl-3H-1-benzofuran-2-one;iodomethane (PubChem CID 158736643) has the molecular formula C46H57IO4 and a molecular weight of 800.86 g/mol. Its IUPAC name is 5,7-ditert-butyl-3-methyl-3-phenyl-1-benzofuran-2-one;5,7-ditert-butyl-3-phenyl-3H-1-benzofuran-2-one;iodomethane.
| Compound Name | 5,7-ditert-butyl-3-methyl-3-phenyl-1-benzofuran-2-one;5,7-ditert-butyl-3-phenyl-3H-1-benzofuran-2-one;iodomethane |
|---|---|
| PubChem CID | 158736643 |
| Molecular Formula | C46H57IO4 |
| Molecular Weight | 800.86 g/mol |
| Exact Mass | 800.33 |
| IUPAC Name | 5,7-ditert-butyl-3-methyl-3-phenyl-1-benzofuran-2-one;5,7-ditert-butyl-3-phenyl-3H-1-benzofuran-2-one;iodomethane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1)C(C)(c1ccccc1)C(=O)O2.CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OC(=O)C2c1ccccc1.CI |
| InChI | InChI=1S/C23H28O2.C22H26O2.CH3I/c1-21(2,3)16-13-17(22(4,5)6)19-18(14-16)23(7,20(24)25-19)15-11-9-8-10-12-15;1-21(2,3)15-12-16-18(14-10-8-7-9-11-14)20(23)24-19(16)17(13-15)22(4,5)6;1-2/h8-14H,1-7H3;7-13,18H,1-6H3;1H3 |
| InChIKey | ILTLXTFQPZARGN-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.86 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|