About 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid
1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid (PubChem CID 158737341) has the molecular formula C12H13BrCl2N2O2
and a molecular weight of 368.06 g/mol. Its IUPAC name is 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid |
| PubChem CID | 158737341 |
| Molecular Formula | C12H13BrCl2N2O2 |
| Molecular Weight | 368.06 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid |
| SMILES | ClCCBr.O=C(O)c1c2ccccc2nn1CCCl |
| InChI | InChI=1S/C10H9ClN2O2.C2H4BrCl/c11-5-6-13-9(10(14)15)7-3-1-2-4-8(7)12-13;3-1-2-4/h1-4H,5-6H2,(H,14,15);1-2H2 |
| InChIKey | ILVPGSHDLSZYJA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.06 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid?
The IUPAC name of 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid (CID 158737341) is 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid.
What is the SMILES notation for 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid?
The canonical SMILES for 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid is ClCCBr.O=C(O)c1c2ccccc2nn1CCCl.
What is the InChIKey of 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid?
The InChIKey is ILVPGSHDLSZYJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O2.C2H4BrCl/c11-5-6-13-9(10(14)15)7-3-1-2-4-8(7)12-13;3-1-2-4/h1-4H,5-6H2,(H,14,15);1-2H2.
What are the key properties of 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid?
1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid has a molecular weight of 368.06 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-chloroethane;2-(2-chloroethyl)indazole-3-carboxylic acid is sourced from PubChem (CID 158737341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).