C30H56N4 — CID 158738502
N,1-ditert-butylpiperidin-2-imine;N,1-ditert-butyl-3,4,5,6-tetramethylpyridin-2-imine (PubChem CID 158738502) has the molecular formula C30H56N4 and a molecular weight of 472.81 g/mol. Its IUPAC name is N,1-ditert-butylpiperidin-2-imine;N,1-ditert-butyl-3,4,5,6-tetramethylpyridin-2-imine.
| Compound Name | N,1-ditert-butylpiperidin-2-imine;N,1-ditert-butyl-3,4,5,6-tetramethylpyridin-2-imine |
|---|---|
| PubChem CID | 158738502 |
| Molecular Formula | C30H56N4 |
| Molecular Weight | 472.81 g/mol |
| Exact Mass | 472.45 |
| IUPAC Name | N,1-ditert-butylpiperidin-2-imine;N,1-ditert-butyl-3,4,5,6-tetramethylpyridin-2-imine |
| SMILES | CC(C)(C)/N=C1\CCCCN1C(C)(C)C.Cc1c(C)c(C)n(C(C)(C)C)/c(=N/C(C)(C)C)c1C |
| InChI | InChI=1S/C17H30N2.C13H26N2/c1-11-12(2)14(4)19(17(8,9)10)15(13(11)3)18-16(5,6)7;1-12(2,3)14-11-9-7-8-10-15(11)13(4,5)6/h1-10H3;7-10H2,1-6H3/b18-15+;14-11+ |
| InChIKey | ILZGYNWWAJCYHE-KEFYEHKMSA-N |
| XLogP | 7.64 |
| TPSA | 32.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.81 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|