C36H34N2O10S — CID 158739109
3-(2,1,3-benzothiadiazol-5-yl)-5-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]-5-hydroxyfuran-2-one;3,4-dimethoxybenzaldehyde (PubChem CID 158739109) has the molecular formula C36H34N2O10S and a molecular weight of 686.74 g/mol. Its IUPAC name is 3-(2,1,3-benzothiadiazol-5-yl)-5-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]-5-hydroxyfuran-2-one;3,4-dimethoxybenzaldehyde.
| Compound Name | 3-(2,1,3-benzothiadiazol-5-yl)-5-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]-5-hydroxyfuran-2-one;3,4-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 158739109 |
| Molecular Formula | C36H34N2O10S |
| Molecular Weight | 686.74 g/mol |
| Exact Mass | 686.19 |
| IUPAC Name | 3-(2,1,3-benzothiadiazol-5-yl)-5-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]-5-hydroxyfuran-2-one;3,4-dimethoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1OC.COc1ccc(CC2=C(c3ccc4nsnc4c3)C(=O)OC2(O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H24N2O7S.C9H10O3/c1-32-21-9-5-15(12-23(21)34-3)11-18-25(16-6-8-19-20(13-16)29-37-28-19)26(30)36-27(18,31)17-7-10-22(33-2)24(14-17)35-4;1-11-8-4-3-7(6-10)5-9(8)12-2/h5-10,12-14,31H,11H2,1-4H3;3-6H,1-2H3 |
| InChIKey | IMBDSQHXVSHOCY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.74 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|