C25H28N2O3 — CID 158740028
(3S)-3-amino-3-benzylhex-5-yn-2-one;(2S)-2-amino-2-benzylpent-4-ynoic acid (PubChem CID 158740028) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3S)-3-amino-3-benzylhex-5-yn-2-one;(2S)-2-amino-2-benzylpent-4-ynoic acid.
| Compound Name | (3S)-3-amino-3-benzylhex-5-yn-2-one;(2S)-2-amino-2-benzylpent-4-ynoic acid |
|---|---|
| PubChem CID | 158740028 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (3S)-3-amino-3-benzylhex-5-yn-2-one;(2S)-2-amino-2-benzylpent-4-ynoic acid |
| SMILES | C#CC[C@](N)(Cc1ccccc1)C(=O)O.C#CC[C@](N)(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C13H15NO.C12H13NO2/c1-3-9-13(14,11(2)15)10-12-7-5-4-6-8-12;1-2-8-12(13,11(14)15)9-10-6-4-3-5-7-10/h1,4-8H,9-10,14H2,2H3;1,3-7H,8-9,13H2,(H,14,15)/t13-;12-/m00/s1 |
| InChIKey | IMEDHAJUQHKBPL-IMECTCCJSA-N |
| XLogP | 2.57 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|