C24H40O5 — CID 158740195
(1S,3S,7S,10R,11S,12S,16R)-3-acetyl-7,8,8,10,11,12,16-heptamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 158740195) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-3-acetyl-7,8,8,10,11,12,16-heptamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-3-acetyl-7,8,8,10,11,12,16-heptamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 158740195 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-3-acetyl-7,8,8,10,11,12,16-heptamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=O)[C@@H]1C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(=O)O1 |
| InChI | InChI=1S/C24H40O5/c1-14-10-9-11-24(8)20(29-24)13-19(18(5)25)28-21(26)12-15(2)23(6,7)22(27)17(4)16(14)3/h14-17,19-20H,9-13H2,1-8H3/t14-,15-,16-,17+,19-,20-,24+/m0/s1 |
| InChIKey | IMESJAGZMBNJPG-XOYXLDFRSA-N |
| XLogP | 4.75 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|