About 2-ethylguanidine;2-methylguanidine
2-ethylguanidine;2-methylguanidine (PubChem CID 158740686) has the molecular formula C5H16N6
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-ethylguanidine;2-methylguanidine.
Molecular Properties
| Compound Name | 2-ethylguanidine;2-methylguanidine |
| PubChem CID | 158740686 |
| Molecular Formula | C5H16N6 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | 2-ethylguanidine;2-methylguanidine |
| SMILES | CCN=C(N)N.CN=C(N)N |
| InChI | InChI=1S/C3H9N3.C2H7N3/c1-2-6-3(4)5;1-5-2(3)4/h2H2,1H3,(H4,4,5,6);1H3,(H4,3,4,5) |
| InChIKey | IMGIALBITFIYNH-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylguanidine;2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylguanidine;2-methylguanidine?
The IUPAC name of 2-ethylguanidine;2-methylguanidine (CID 158740686) is 2-ethylguanidine;2-methylguanidine.
What is the SMILES notation for 2-ethylguanidine;2-methylguanidine?
The canonical SMILES for 2-ethylguanidine;2-methylguanidine is CCN=C(N)N.CN=C(N)N.
What is the InChIKey of 2-ethylguanidine;2-methylguanidine?
The InChIKey is IMGIALBITFIYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3.C2H7N3/c1-2-6-3(4)5;1-5-2(3)4/h2H2,1H3,(H4,4,5,6);1H3,(H4,3,4,5).
What are the key properties of 2-ethylguanidine;2-methylguanidine?
2-ethylguanidine;2-methylguanidine has a molecular weight of 160.22 g/mol, XLogP of -1.83, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylguanidine;2-methylguanidine is sourced from PubChem (CID 158740686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).