C39H44N2O7S2 — CID 158740713
[4-[2-[4-[(5S)-5-hydroxy-5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]phenoxy]ethyl-methylamino]cyclohexyl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 158740713) has the molecular formula C39H44N2O7S2 and a molecular weight of 716.92 g/mol. Its IUPAC name is [4-[2-[4-[(5S)-5-hydroxy-5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]phenoxy]ethyl-methylamino]cyclohexyl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [4-[2-[4-[(5S)-5-hydroxy-5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]phenoxy]ethyl-methylamino]cyclohexyl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 158740713 |
| Molecular Formula | C39H44N2O7S2 |
| Molecular Weight | 716.92 g/mol |
| Exact Mass | 716.26 |
| IUPAC Name | [4-[2-[4-[(5S)-5-hydroxy-5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]phenoxy]ethyl-methylamino]cyclohexyl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CN(CCOc1ccc(CCCC[C@H](O)c2ccc(O)c3[nH]c(=O)ccc23)cc1)C1CCC(OC(=O)C(O)(c2cccs2)c2cccs2)CC1 |
| InChI | InChI=1S/C39H44N2O7S2/c1-41(27-12-16-29(17-13-27)48-38(45)39(46,34-8-4-24-49-34)35-9-5-25-50-35)22-23-47-28-14-10-26(11-15-28)6-2-3-7-32(42)30-18-20-33(43)37-31(30)19-21-36(44)40-37/h4-5,8-11,14-15,18-21,24-25,27,29,32,42-43,46H,2-3,6-7,12-13,16-17,22-23H2,1H3,(H,40,44)/t27?,29?,32-/m0/s1 |
| InChIKey | PDVRTGVRSMPLDR-GHIDTHINSA-N |
| XLogP | 6.90 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.92 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|