C20H21BN2O5 — CID 158740793
[1-(2-hydroxy-3-methylphenyl)-4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-oxobutan-2-yl]boronic acid (PubChem CID 158740793) has the molecular formula C20H21BN2O5 and a molecular weight of 380.21 g/mol. Its IUPAC name is [1-(2-hydroxy-3-methylphenyl)-4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-oxobutan-2-yl]boronic acid.
| Compound Name | [1-(2-hydroxy-3-methylphenyl)-4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-oxobutan-2-yl]boronic acid |
|---|---|
| PubChem CID | 158740793 |
| Molecular Formula | C20H21BN2O5 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [1-(2-hydroxy-3-methylphenyl)-4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-oxobutan-2-yl]boronic acid |
| SMILES | Cc1nc(-c2cccc(C(=O)CC(Cc3cccc(C)c3O)B(O)O)c2)no1 |
| InChI | InChI=1S/C20H21BN2O5/c1-12-5-3-7-15(19(12)25)10-17(21(26)27)11-18(24)14-6-4-8-16(9-14)20-22-13(2)28-23-20/h3-9,17,25-27H,10-11H2,1-2H3 |
| InChIKey | UFPCVHGSZIPEJX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|