C24H45ClN4O6 — CID 158741128
ethyl carbonochloridate;ethyl 4-morpholin-4-ylpiperidine-1-carboxylate;4-piperidin-4-ylmorpholine (PubChem CID 158741128) has the molecular formula C24H45ClN4O6 and a molecular weight of 521.10 g/mol. Its IUPAC name is ethyl carbonochloridate;ethyl 4-morpholin-4-ylpiperidine-1-carboxylate;4-piperidin-4-ylmorpholine.
| Compound Name | ethyl carbonochloridate;ethyl 4-morpholin-4-ylpiperidine-1-carboxylate;4-piperidin-4-ylmorpholine |
|---|---|
| PubChem CID | 158741128 |
| Molecular Formula | C24H45ClN4O6 |
| Molecular Weight | 521.10 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | ethyl carbonochloridate;ethyl 4-morpholin-4-ylpiperidine-1-carboxylate;4-piperidin-4-ylmorpholine |
| SMILES | C1CC(N2CCOCC2)CCN1.CCOC(=O)Cl.CCOC(=O)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C12H22N2O3.C9H18N2O.C3H5ClO2/c1-2-17-12(15)14-5-3-11(4-6-14)13-7-9-16-10-8-13;1-3-10-4-2-9(1)11-5-7-12-8-6-11;1-2-6-3(4)5/h11H,2-10H2,1H3;9-10H,1-8H2;2H2,1H3 |
| InChIKey | IMHQBZZNYNJUOH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|