C48H58N4O5Si2 — CID 158742426
5-[tert-butyl(dimethyl)silyl]oxypyridin-2-amine;N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-3-phenylbenzamide;3-phenylbenzoic acid (PubChem CID 158742426) has the molecular formula C48H58N4O5Si2 and a molecular weight of 827.19 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxypyridin-2-amine;N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-3-phenylbenzamide;3-phenylbenzoic acid.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxypyridin-2-amine;N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-3-phenylbenzamide;3-phenylbenzoic acid |
|---|---|
| PubChem CID | 158742426 |
| Molecular Formula | C48H58N4O5Si2 |
| Molecular Weight | 827.19 g/mol |
| Exact Mass | 826.39 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxypyridin-2-amine;N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-3-phenylbenzamide;3-phenylbenzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(N)nc1.CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)c2cccc(-c3ccccc3)c2)nc1.O=C(O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H28N2O2Si.C13H10O2.C11H20N2OSi/c1-24(2,3)29(4,5)28-21-14-15-22(25-17-21)26-23(27)20-13-9-12-19(16-20)18-10-7-6-8-11-18;14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;1-11(2,3)15(4,5)14-9-6-7-10(12)13-8-9/h6-17H,1-5H3,(H,25,26,27);1-9H,(H,14,15);6-8H,1-5H3,(H2,12,13) |
| InChIKey | IMLRLJKPIPFQMI-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.19 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|