C23H20N4O4S — CID 158744155
N-[4-[2-[3-amino-6-(3H-inden-5-yl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide (PubChem CID 158744155) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is N-[4-[2-[3-amino-6-(3H-inden-5-yl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[2-[3-amino-6-(3H-inden-5-yl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 158744155 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[4-[2-[3-amino-6-(3H-inden-5-yl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(CC(=O)c2nc(-c3ccc4c(c3)CC=C4)cnc2N)cc1 |
| InChI | InChI=1S/C23H20N4O4S/c1-14(28)27-32(30,31)19-9-5-15(6-10-19)11-21(29)22-23(24)25-13-20(26-22)18-8-7-16-3-2-4-17(16)12-18/h2-3,5-10,12-13H,4,11H2,1H3,(H2,24,25)(H,27,28) |
| InChIKey | XZDFWPXRAHOZAM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |