About difluoromethane;5-fluoro-2-methylpyrimidine
difluoromethane;5-fluoro-2-methylpyrimidine (PubChem CID 158744420) has the molecular formula C6H7F3N2
and a molecular weight of 164.13 g/mol. Its IUPAC name is difluoromethane;5-fluoro-2-methylpyrimidine.
Molecular Properties
| Compound Name | difluoromethane;5-fluoro-2-methylpyrimidine |
| PubChem CID | 158744420 |
| Molecular Formula | C6H7F3N2 |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | difluoromethane;5-fluoro-2-methylpyrimidine |
| SMILES | Cc1ncc(F)cn1.FCF |
| InChI | InChI=1S/C5H5FN2.CH2F2/c1-4-7-2-5(6)3-8-4;2-1-3/h2-3H,1H3;1H2 |
| InChIKey | IMRYHPCWPJMEQJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze difluoromethane;5-fluoro-2-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethane;5-fluoro-2-methylpyrimidine?
The IUPAC name of difluoromethane;5-fluoro-2-methylpyrimidine (CID 158744420) is difluoromethane;5-fluoro-2-methylpyrimidine.
What is the SMILES notation for difluoromethane;5-fluoro-2-methylpyrimidine?
The canonical SMILES for difluoromethane;5-fluoro-2-methylpyrimidine is Cc1ncc(F)cn1.FCF.
What is the InChIKey of difluoromethane;5-fluoro-2-methylpyrimidine?
The InChIKey is IMRYHPCWPJMEQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FN2.CH2F2/c1-4-7-2-5(6)3-8-4;2-1-3/h2-3H,1H3;1H2.
What are the key properties of difluoromethane;5-fluoro-2-methylpyrimidine?
difluoromethane;5-fluoro-2-methylpyrimidine has a molecular weight of 164.13 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethane;5-fluoro-2-methylpyrimidine is sourced from PubChem (CID 158744420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).