About methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate
methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate (PubChem CID 158744811) has the molecular formula C18H16N6O6
and a molecular weight of 412.36 g/mol. Its IUPAC name is methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate |
| PubChem CID | 158744811 |
| Molecular Formula | C18H16N6O6 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cc(N)cc2[nH]cnc12.COC(=O)c1cc([N+](=O)[O-])cc2[nH]cnc12 |
| InChI | InChI=1S/C9H7N3O4.C9H9N3O2/c1-16-9(13)6-2-5(12(14)15)3-7-8(6)11-4-10-7;1-14-9(13)6-2-5(10)3-7-8(6)12-4-11-7/h2-4H,1H3,(H,10,11);2-4H,10H2,1H3,(H,11,12) |
| InChIKey | IMTFSGZVRACIOT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 179.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate?
The IUPAC name of methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate (CID 158744811) is methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate.
What is the SMILES notation for methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate?
The canonical SMILES for methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate is COC(=O)c1cc(N)cc2[nH]cnc12.COC(=O)c1cc([N+](=O)[O-])cc2[nH]cnc12.
What is the InChIKey of methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate?
The InChIKey is IMTFSGZVRACIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O4.C9H9N3O2/c1-16-9(13)6-2-5(12(14)15)3-7-8(6)11-4-10-7;1-14-9(13)6-2-5(10)3-7-8(6)12-4-11-7/h2-4H,1H3,(H,10,11);2-4H,10H2,1H3,(H,11,12).
What are the key properties of methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate?
methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate has a molecular weight of 412.36 g/mol, XLogP of 2.19, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-amino-1H-benzimidazole-4-carboxylate;methyl 6-nitro-1H-benzimidazole-4-carboxylate is sourced from PubChem (CID 158744811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).